| Name | 2-(2-hydroxyethoxy)phenol |
| Synonyms | TIMTEC-BB SBB008523 m-Hydroxyphenyl glycol o-(Hydroxyethoxy)phenol 2-(2-hydroxyethoxy)-pheno 2-(2-HYDROXYETHOXY)PHENOL 2-(2-hydroxyethoxy)phenol CATECHOL HYDROXYETHYL ETHER 2-(.beta.-Hydroxyethoxy)phenol Catechol,mono(.beta.-hydroxyethyl)ether |
| CAS | 4792-78-3 |
| EINECS | 225-346-1 |
| InChI | InChI=1/C8H10O3/c9-5-6-11-8-4-2-1-3-7(8)10/h1-4,9-10H,5-6H2 |
| InChIKey | AMCOCUDBDKVWRZ-UHFFFAOYSA-N |
| Molecular Formula | C8H10O3 |
| Molar Mass | 154.16 |
| Density | 1.1690 (rough estimate) |
| Melting Point | 99-100 °C (lit.) |
| Boling Point | 128 °C/0.7 mmHg (lit.) |
| Flash Point | 135.7°C |
| Vapor Presure | 0.00049mmHg at 25°C |
| pKa | 9.51±0.30(Predicted) |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.4750 (estimate) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 1 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |