| Name | 2-(2-chlorophenoxy)ethylamine |
| Synonyms | AURORA KA-7595 RARECHEM AL BW 0341 2-Chlorophenoxy-2-ethaneamine 2-(2-chlorophenoxy)ethanamine 2-(2-chlorophenoxy)ethylamine 2-(2-CHLOROPHENOXY)ETHYLAMINE 2-CHLOROPHENOXY-2-ETHANEAMINE 2-(2-CHLOROPHENOXY)-1-ETHANAMINE 1-ETHANAMINE, 2-(2-CHLOROPHENOXY)- [2-(2-chlorophenoxy)ethyl]amine hydrochloride |
| CAS | 26378-53-0 |
| InChI | InChI=1/C8H10ClNO/c9-7-3-1-2-4-8(7)11-6-5-10/h1-4H,5-6,10H2 |
| Molecular Formula | C8H10ClNO |
| Molar Mass | 171.62 |
| Density | 1.178±0.06 g/cm3(Predicted) |
| Melting Point | 39-40°C |
| Boling Point | 115-117°C 5mm |
| Flash Point | 150-153°C/18mm |
| Vapor Presure | 0.00879mmHg at 25°C |
| pKa | 8.32±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | Moisture Sensitive |
| Refractive Index | 1.544 |
| MDL | MFCD00125294 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | 2735 |
| Hazard Note | Irritant |
| Hazard Class | 8 |
| Packing Group | III |