| Name | 2,2-Diethoxyethanethioamide |
| Synonyms | 2,2-Diethoxythioacetamide 2,2-Diethoxyethanethioamide 2,2-DIETHOXYETHANETHIOAMIDE Ethanethioamide,2,2-diethoxy- ethanethioamide, 2,2-diethoxy- |
| CAS | 73956-15-7 |
| InChI | InChI=1/C6H13NO2S/c1-3-8-6(5(7)10)9-4-2/h6H,3-4H2,1-2H3,(H2,7,10) |
| Molecular Formula | C6H13NO2S |
| Molar Mass | 163.24 |
| Density | 1.093±0.06 g/cm3(Predicted) |
| Melting Point | 91-94 ºC |
| Boling Point | 214.5±50.0 °C(Predicted) |
| Flash Point | 83.5°C |
| Vapor Presure | 0.155mmHg at 25°C |
| pKa | 12.46±0.29(Predicted) |
| Storage Condition | -20℃ |
| Refractive Index | 1.502 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |