| Name | ETHYL COUMARIN-3-CARBOXYLATE |
| Synonyms | AURORA KA-28 RARECHEM AB KA K001 3-Carbethoxycoumarin 3-Ethoxycarbonylcoumarin thyl 3-coumarincarboxylate ETHYL 3-COUMARINCARBOXYLATE ETHYL COUMARIN-3-CARBOXYLATE ETHYL 2-OXO-2H-CHROMENE-3-CARBOXYLATE 2-Oxo-2H-chromene-3-carboxylic acid ethyl ester 2-oxo-2h-1-benzopyran-3-carboxylicaciethylester 1,2-benzopyran-2-one-3-carboxylicacid,ethylester 1,2-Benzopyran-2-one-3-carboxylic acid, ethyl ester 2H-1-Benzopyran-3-carboxylic acid, 2-oxo-, ethyl ester |
| CAS | 1846-76-0 |
| EINECS | 811-043-7 |
| InChI | InChI=1/C12H10O4/c1-2-15-11(13)9-7-8-5-3-4-6-10(8)16-12(9)14/h3-7H,2H2,1H3 |
| InChIKey | XKHPEMKBJGUYCM-UHFFFAOYSA-N |
| Molecular Formula | C12H10O4 |
| Molar Mass | 218.21 |
| Density | 1.1096 (rough estimate) |
| Melting Point | 92-94 °C (lit.) |
| Boling Point | 278.88°C (rough estimate) |
| Flash Point | 195.6°C |
| Vapor Presure | 6.48E-06mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| Maximum wavelength(λmax) | ['334nm(CH2Cl2)(lit.)'] |
| BRN | 200147 |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.4270 (estimate) |
| MDL | MFCD00016964 |
| Physical and Chemical Properties | WGK Germany:3 RTECS:DJ2501000 |
| Hazard Symbols | Xi - Irritant![]() |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | DJ2501000 |
| HS Code | 29322090 |
| Hazard Class | IRRITANT |
| Biological activity | Ethyl 3-coumarinboxylate is a coumarin derivative. Ethyl 3-coumarincarboxylate can be used as a pseudo-template for the preparation of molecularly imprinted polymers (MIPs) with more specific recognition capabilities for aflatoxins. |