| Name | N,N-Diethyl-guanidine |
| Synonyms | 1,1-DIETHYLGUANIDINE 1,1-Diethylguanidine Metformin Impurity 27 N,N-DIETHYL-GUANIDINE N,N-Diethyl-guanidine Guanidine, N,N-diethyl- |
| CAS | 18240-93-2 |
| InChI | InChI=1/C5H13N3/c1-3-8(4-2)5(6)7/h3-4H2,1-2H3,(H3,6,7) |
| Molecular Formula | C5H13N3 |
| Molar Mass | 115.18 |
| Density | 0.99±0.1 g/cm3(Predicted) |
| Melting Point | 220 °C |
| Boling Point | 154.6±23.0 °C(Predicted) |
| Flash Point | 47.3°C |
| Vapor Presure | 3.16mmHg at 25°C |
| pKa | 14.47±0.70(Predicted) |
| Refractive Index | 1.484 |
| Physical and Chemical Properties | Character: white granular crystals |
| Use | Purposes: used as pesticide intermediates. For organic synthesis. Diguanidine sulfate is an important raw material for organic synthesis, especially in the synthesis of pharmaceuticals and pesticides. In the synthesis of pesticides, it is an important intermediate for the synthesis of many pesticides, such as methyl pyrimidine, pyrimidine, ethidium, trimethoprim and pirimicarb. |