| Name | Diethyl 2,5-Dibromoterephthalate |
| Synonyms | ethyl 2,5-dibromoterephthala ethyl 2,5-dibromoterephthalate Diethyl 2,5-Dibromoterephthalate Diethyl 2,5-dibromoterephthalate 2,5-Dibromoterephthalic Acid Diethyl Ester 2,5-Dibromoterephthalic acid diethyl ester diethyl 2,5-dibromobenzene-1,4-dicarboxylate Diethyl 1,4-dibromo-2,5-benzenedicarboxylate Diethyl 2,5-dibromo-1,4-benzenedicarboxylate Diethyl 2,5-dibromobenzene-1,4-dicarboxylate 1,4-benzenedicarboxylic acid, 2,5-dibromo-, diethyl ester 1,4-Benzenedicarboxylicacid, 2,5-dibromo-, 1,4-diethyl ester |
| CAS | 18013-97-3 |
| InChI | InChI=1/C12H12Br2O4/c1-3-17-11(15)7-5-10(14)8(6-9(7)13)12(16)18-4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | WXRSDHICEYICMV-UHFFFAOYSA-N |
| Molecular Formula | C12H12Br2O4 |
| Molar Mass | 380.03 |
| Density | 1.647±0.06 g/cm3(Predicted) |
| Melting Point | 127.0 to 131.0 °C |
| Boling Point | 335°C(lit.) |
| Flash Point | 188.644°C |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | Solid |
| Color | White to Almost white |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.559 |
| application | 2, 5-dibromo terephthalate diethyl ester is an organic intermediate that can be used to prepare high-efficiency wear-resistant brush roller materials or organic solar cell acceptor materials or perovskite battery electron transport layer materials. |