| Name | 3,4-difluorohydrocinnamic acid |
| Synonyms | 3,4-Difluorohydrociamicacid 3,4-difluorohydrocinnamic acid 3,4-DIFLUOROHYDROCINNAMIC ACID Benzenepropanoicacid,3,4-difluoro 3-(3,4-difluorophenyl)propanoic acid 3-(3,4-Difluorophenyl)propanoic acid 3-(3,4-DIFLUOROPHENYL)PROPANOIC ACID 3-(3,4-DIFLUOROPHENYL)-PROPIONIC ACID 3,4-Difluorohydrocinnamic acid, 3-(3,4-Difluorophenyl)propionic acid |
| CAS | 161712-75-0 |
| InChI | InChI=1/C9H8F2O2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5H,2,4H2,(H,12,13) |
| Molecular Formula | C9H8F2O2 |
| Molar Mass | 186.16 |
| Density | 1.312 |
| Melting Point | 49-53 °C (lit.) |
| Boling Point | 278℃ |
| Flash Point | 122℃ |
| Vapor Presure | 0.00213mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.503 |
| MDL | MFCD00799520 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Hazard Note | Irritant |