| Name | Dimethyl 2-(2-methoxyphenoxy)malonate |
| Synonyms | 2-MethoxyphenoxyMalonate DIMETHYL (2-METHOXYPHENOXY)MALONATE Dimethyl (o-Methoxyphenoxy)malonate Dimethyl 2-(2-methoxyphenoxy)malonate Dimethyl-2-(2-methoxyphenoxy)malonate dimethyl (2-methoxyphenoxy)propanedioate 1,3-diMethyl 2-(2-Methoxyphenoxy)propanedioate 2-(2-Methoxyphenoxy)malonic acid dimethyl ester 2-methoxy-2-phenoxypropanedioic acid dimethyl ester (2-Methoxyphenoxy)-propanedioic Acid Dimethyl Ester |
| CAS | 150726-89-9 |
| EINECS | 604-747-9 |
| InChI | InChI=1/C12H14O6/c1-15-8-6-4-5-7-9(8)18-10(11(13)16-2)12(14)17-3/h4-7,10H,1-3H3 |
| Molecular Formula | C12H14O6 |
| Molar Mass | 254.24 |
| Density | 1.206±0.06 g/cm3(Predicted) |
| Boling Point | 320.5±27.0 °C(Predicted) |
| Flash Point | 138.381°C |
| Solubility | Dichloromethane, Methanol |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | Solid |
| Color | White |
| pKa | 12.17±0.59(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.497 |
| Use | dimethyl 2-(2-methoxyphenoxy) malonate is useful as a pharmaceutical synthesis intermediate. |
| preparation | dimethyl 2-(2-methoxyphenoxy) malonate was prepared as follows: 2-methoxyphenol (805.54g, 33.83 mmol) was dissolved in toluene (845.75 mL) at 20-30 °c and sodium hydroxide (g, mmol) was added. The reaction mass was heated to reflux temperature and water was separated azeotropically. Thereafter, dimethyl chloromalonate (147.6g,886.16mmol) was added over 30 minutes at 60-65 °c and heated to reflux temperature and stirred for 3 hours. The reaction mass was cooled to room temperature, washed with DM water, then washed with 1% w / v aqueous sodium hydroxide solution and concentrated to give 195g of the title compound dimethyl 2-(2-methoxyphenoxy) malonate. |