| Name | 1-Bromo-2,5-dichlorobenzene |
| Synonyms | 2,5-DICHLOROBROMOBENZENE 2,5-Dichlorobeomobenzene 2,5-Dichlorophenyl bromide 2-BROMO-1,4-DICHLOROBENZENE 1-BROMO-2,5-DICHLOROBENZENE 1-Bromo-2,5-dichlorobenzene 2-Bromo-1,4-dichlorobenzene Benzene, 1-bromo-2,5-dichloro- 1-BroMo-2,5-dichlorobenzene[2,5-DichlorobroMobenzene] |
| CAS | 1435-50-3 |
| EINECS | 215-859-9 |
| InChI | InChI=1/C6H3BrCl2/c7-5-3-4(8)1-2-6(5)9/h1-3H |
| Molecular Formula | C6H3BrCl2 |
| Molar Mass | 225.9 |
| Density | 1.6351 (rough estimate) |
| Melting Point | 32-36°C(lit.) |
| Boling Point | 118-120°C 20mm |
| Flash Point | >230°F |
| Water Solubility | insoluble |
| Vapor Presure | 0.0736mmHg at 25°C |
| Appearance | Low melting point solid |
| BRN | 1934815 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5700 (estimate) |
| MDL | MFCD00018505 |
| Physical and Chemical Properties | Melting point 32-36°C(lit.) boiling point 118-120 ° C 20mm flash point> 230 ° F water-soluble insoluble BRN 1934815 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S28A - |
| WGK Germany | 3 |
| HS Code | 29039990 |
| Hazard Note | Toxic |
| Hazard Class | IRRITANT |
| NIST chemical information | The information is: webbook.nist.gov provides (external link) |
| EPA chemical information | The information is: offered by ofmpub.epa.gov (external link) |