| Name | 1-Ethyl-3-methylimidazolium tetrafluoroborate |
| Synonyms | EMIMBF4 formoltensalt Ethylmethylimidazoliumtetrafluoroborate 1-Ethyl-3-methylimidazolium tetrafluorob 1-Ethyl-3-methylimidazolium tetrafluoroborate 1-ETHYL-3-METHYLIMIDAZOLIUM TETRAFLUOROBORATE 1-ETHYL-3-METHYL-1 H-IMIDAZOLIUM TETRAFLUOROBORATE 1-ethyl-3-methyl-1H-imidazol-3-ium tetrafluoroborate |
| CAS | 143314-16-3 |
| EINECS | 671-177-5 |
| InChI | InChI=1/C6H11N2.BF4/c1-3-8-5-4-7(2)6-8;2-1(3,4)5/h4-6H,3H2,1-2H3;/q+1;-1 |
| InChIKey | RNBAQXLNJMVTCI-UHFFFAOYSA-M |
| Molecular Formula | C6H11BF4N2 |
| Molar Mass | 197.97 |
| Density | 1.294 g/mL at 25 °C (lit.) |
| Melting Point | 15 °C (lit.) |
| Boling Point | >350 °C (lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0-0Pa at 20-25℃ |
| Appearance | Transparent liquid |
| Color | Colorless to Light orange to Yellow |
| Storage Condition | Sealed in dry,Room Temperature |
| Sensitive | Hygroscopic |
| Refractive Index | n20/D 1.413(lit.) |
| MDL | MFCD00216668 |
| Physical and Chemical Properties | WGK Germany:3 |
| Risk Codes | R36/38 - Irritating to eyes and skin. R51/53 - Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. R22 - Harmful if swallowed R24/25 - R23 - Toxic by inhalation |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. S61 - Avoid release to the environment. Refer to special instructions / safety data sheets. |
| UN IDs | UN3082 9/PG 3 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 3-10 |
| HS Code | 29332900 |
| Hazard Class | 8 |
| Packing Group | III |
| ECW | 3.6 - 4.0 V |
| Introduction | 1-ethyl-3-methylimidazolium tetrafluoroborate can use 1-ethyl-3-methylimidazolium tetrafluoroborate As the reaction medium, perform enzymatic resolution of high phenylalanine esters to form an enantiomeric high phenylalanine, air and water stable liquid electrolyte. |
| Application | 1-ethyl-3-methylimidazole tetrafluoroborate is a carboxylic acid organic substance and can be used as a pharmaceutical intermediate. |
| use | for molten salt |