| Name | N,N'-(p-phenylene)di(acetamide) |
| Synonyms | TIMTEC-BB SBB006302 p-Diacetamidobenzene 1,4-Bisacetamidobenzene N,N-p-Phenylenebisacetamide NN-1,4-Phenylenebisacetamide N,N'-P-PHENYLENEBISACETAMIDE N,N'-Diacetylphenylenediamine N,N'-DIACETYLPHENYLENEDIAMINE N,N'-1,4-PHENYLENEBISACETAMIDE N,N'-(p-phenylene)di(acetamide) N',N-DIACETYL-P-PHENYLENEDIAMINE N,N'-benzene-1,4-diyldiacetamide N,N'-DIACETYL-1,4-PHENYLENEDIAMINE N,N-p-Phenylenebisacetamide, (N,N-Diacetyl-p-phenylene- diamine) |
| CAS | 140-50-1 |
| EINECS | 205-417-3 |
| InChI | InChI=1/C10H12N2O2/c1-7(13)11-9-3-5-10(6-4-9)12-8(2)14/h3-6H,1-2H3,(H,11,13)(H,12,14) |
| Molecular Formula | C10H12N2O2 |
| Molar Mass | 192.21 |
| Density | 1.235±0.06 g/cm3(Predicted) |
| Melting Point | >300°C |
| Boling Point | 483.8±28.0 °C(Predicted) |
| Flash Point | 219.6°C |
| Vapor Presure | 1.63E-09mmHg at 25°C |
| BRN | 2806271 |
| pKa | 14.29±0.70(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.621 |
| MDL | MFCD00026142 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | 2811 |
| RTECS | AC7709500 |
| TSCA | Yes |
| Hazard Class | 6.1 |
| Packing Group | III |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |