| Name | 2-isocyanatoethyl prop-2-enoate |
| Synonyms | AOI-VM 2-IsocyatoethylAcrylate 2-IsocyanatoethylAcrylate 2-Isocyanatoethyl acrylate 2-Isocyanatoethyl 2-propenoate 2-(Acryloyloxy)ethyl Isocyanate 2-isocyanatoethyl prop-2-enoate 2-Propenoic acid 2-isocyanatoethyl ester 2-propenoic acid, 2-isocyanatoethyl ester 2-Isocyanatoethyl Acrylate (stabilized with BHT) |
| CAS | 13641-96-8 |
| EINECS | 482-140-6 |
| InChI | InChI=1/C6H7NO3/c1-2-6(9)10-4-3-7-5-8/h2H,1,3-4H2 |
| Molecular Formula | C6H7NO3 |
| Molar Mass | 141.12 |
| Density | 1.05 |
| Melting Point | -25 °C |
| Boling Point | 80-95 °C(Press: 15 Torr) |
| Flash Point | 97°C(lit.) |
| Vapor Presure | 21.4Pa at 20℃ |
| Appearance | clear liquid |
| Color | Colorless to Almost colorless |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.4470 to 1.4510 |
| UN IDs | UN 2206 6.1/PG III |
| Hazard Class | 6.1 |
| Packing Group | III |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | ethyl isocyanate acrylate is used as a research compound. |