| Name | 2,4-Dimethylthiophenol |
| Synonyms | NSC 202925 THIOXYLENOL 2,4-Thioxylenol M-XYLENE-4-THIOL 4-MERCAPTO-M-XYLENE 2,4-Xylenethiol (8CI) 2,4-Dimethylthiophenol 2,4-DIMETHYLTHIOPHENOL 2,4-DIMETHLBENZENETHIOL 2,4-dimethyl-benzenethio 2,4-Dimethylbenzenethiol 2,4-DIMETHYLBENZENETHIOL Benzenethiol, 2,4-dimethyl- 2,4-dimethylbenzenethiolate Benzenethiol, 2,4-dimethyl- (9CI) |
| CAS | 13616-82-5 |
| EINECS | 237-100-0 |
| InChI | InChI=1/C8H10S/c1-6-3-4-8(9)7(2)5-6/h3-5,9H,1-2H3/p-1 |
| Molecular Formula | C8H10S |
| Molar Mass | 138.23 |
| Density | 1.022 g/mL at 25 °C (lit.) |
| Melting Point | -30°C (estimate) |
| Boling Point | 207-208 °C (lit.) |
| Flash Point | 137°F |
| Vapor Presure | 0.315mmHg at 25°C |
| Appearance | clear liquid |
| Specific Gravity | 1.022 |
| Color | Colorless to Light yellow |
| pKa | 7.02±0.48(Predicted) |
| Storage Condition | 2-8°C(protect from light) |
| Sensitive | Stench |
| Refractive Index | n20/D 1.569(lit.) |
| Physical and Chemical Properties | Colorless transparent to light yellow liquid. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S37/39 - Wear suitable gloves and eye/face protection S36 - Wear suitable protective clothing. S7/9 - |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| TSCA | T |
| HS Code | 29309090 |
| Hazard Note | Irritant/Stench |
| Hazard Class | 3 |
| Packing Group | III |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |