| Name | N,N-Bis(2,6-diisopropylphenyl)ethylenediamine |
| Synonyms | N1,N2-Bis(2,6-diisopropyL N,N-Bis(2,6-diisopropylphenyl)ethylenediamine N,N'-Bis(2,6-diisopropylphenyl)ethylenediamine N,Nμ-Bis(2,6-diisopropylphenyl)-1,2-ethanediamine N1,N2-bis(2,6-diisopropylphenyl)ethane-1,2-diamine N1,N2-Bis(2,6-diisopropylphenyl)-1,2-ethanediamine N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diamine N,N'-bis[2,6-bis(1-methylethyl)phenyl]ethane-1,2-diamine 1,2-Ethanediamine, N1,N2-bis[2,6-bis(1-methylethyl)phenyl]- N-(2-aMinoethyl)-N-[2,6-bis(propan-2-yl)phenyl]-2,6-bis(propan-2-yl)aniline |
| CAS | 134030-22-1 |
| InChI | InChI=1/C26H40N2/c1-17(2)21-11-9-12-22(18(3)4)25(21)27-15-16-28-26-23(19(5)6)13-10-14-24(26)20(7)8/h9-14,17-20,27-28H,15-16H2,1-8H3 |
| Molecular Formula | C26H40N2 |
| Molar Mass | 380.61 |
| Density | 0.977±0.06 g/cm3(Predicted) |
| Melting Point | 101-106°C |
| Boling Point | 503.5±50.0 °C(Predicted) |
| Flash Point | 288.9°C |
| Vapor Presure | 2.9E-10mmHg at 25°C |
| pKa | 4.65±0.50(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.562 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| application | N,N'-bis (2,6-diisopropylphenyl) ethylenediamine can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process. |