13104-56-8 - Names and Identifiers
| Name | 4'-(4-methoxyphenyl)-2,2',6',2''-terpyridine
|
| Synonyms | 6',2''-terpyridin 6',2''-terpyridine 4'-(4-Methoxyphenyl)-2,2' 4'-(4-Méthoxyphényl)-2,2' 4'-(4-methoxyphenyl)-2,2',6',2''-terpyridine 2,6-Di[2-pyridyl-4-(p-methoxyphenyl)pyridine 4-(p-Methoxyphenyl)-2,6-di(2-pyridyl)pyridine 4-(4-methoxyphenyl)-2,6-dipyridin-2-ylpyridine 2,6-Di(2-pyridinyl)-4-(4-methoxyphenyl)pyridine
|
| CAS | 13104-56-8 337511-97-4
|
| InChI | InChI=1/C22H17N3O/c1-26-18-10-8-16(9-11-18)17-14-21(19-6-2-4-12-23-19)25-22(15-17)20-7-3-5-13-24-20/h2-15H,1H3 |
13104-56-8 - Physico-chemical Properties
| Molecular Formula | C22H17N3O
|
| Molar Mass | 339.39 |
| Density | 1.174±0.06 g/cm3(Predicted) |
| Melting Point | 167-168℃ |
| Boling Point | 504.5±50.0 °C(Predicted) |
| Flash Point | 178.9°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 8.27E-10mmHg at 25°C |
| Appearance | White powder |
| pKa | 4.62±0.22(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.616 |
| MDL | MFCD06796987 |
13104-56-8 - Introduction
4 '-(4-methoxyphenyl)-2,2':6 ',2 "-terpyridine is an organic compound with the chemical formula C19H17NO. Its properties, uses, preparation methods and safety information are as follows:
Nature:
-Appearance: White to yellowish crystalline powder.
-Solubility: Soluble in organic solvents such as dimethyl sulfoxide, dichloromethane and ethanol, slightly soluble in water.
-Melting point: about 144-147 ℃.
-Structure: It is a terpyridine compound with a methoxyphenyl substituent group.
Use:
- 4 '-(4-methoxyphenyl)-2,2':6 ',2 ''-terpyridine is often used as a ligand in the field of organic synthesis to participate in metal-catalyzed reactions, such as nickel-catalyzed olefin activation.
-It can also be used to synthesize biologically active compounds and drug molecules.
Preparation Method:
The method of preparing 4 '-(4-methoxyphenyl)-2,2':6 ',2 ''-terpyridine can be obtained through a multi-step reaction. A commonly used method is:
1. 4-methoxybenzoic acid was synthesized from benzoic acid by acylation, reduction, methanesulfonic acid and iodination.
2. the required 3-(4-methoxyphenyl) acetone is synthesized by 4-methoxybenzoic acid and acetone through acetone ketopropion reaction.
3. Finally, 3-(4-methoxyphenyl) acetone was reacted with aniline by coupling reaction to obtain the target product 4 '-(4-methoxyphenyl)-2,2':6 ',2 "-terpyridine.
Safety Information:
- 4 '-(4-methoxyphenyl)-2,2':6 ',2 ''-terpyridine should be stored in a dry, low temperature place to avoid moisture and prolonged exposure to air.
-Wear appropriate protective equipment during operation, such as lab gloves, safety goggles, etc.
-In case of contact with skin or eyes, rinse immediately with plenty of water and seek medical help.
-When used in the laboratory, the corresponding safety procedures should be observed.
Last Update:2024-04-09 21:00:56