| Name | 3-(Morpholin-4-ylmethyl)aniline |
| Synonyms | AKOS B016019 AKOS MSC-0189 TIMTEC-BB SBB007086 ART-CHEM-BB B016019 3-(Morpholinomethyl)aniline 3-(4-Morpholinylmethyl)aniline 3-(4-MORPHOLINYLMETHYL)ANILINE 3-(MORPHOLIN-4-YLMETHYL)ANILINE 3-(Morpholin-4-ylmethyl)aniline 3-Morpholin-4-ylmethyl-Phenylamine 3-MORPHOLIN-4-YLMETHYL-PHENYLAMINE Benzenamine,3-(4-morpholinylmethyl)- |
| CAS | 123207-48-7 |
| InChI | InChI=1/C11H16N2O/c12-11-3-1-2-10(8-11)9-13-4-6-14-7-5-13/h1-3,8H,4-7,9,12H2 |
| Molecular Formula | C11H16N2O |
| Molar Mass | 192.26 |
| Density | 1.136g/cm3 |
| Melting Point | 73 °C |
| Boling Point | 0°C |
| Flash Point | 0°C |
| Vapor Presure | 0.000242mmHg at 25°C |
| Storage Condition | 2-8°C(protect from light) |
| Refractive Index | 1.589 |
| Risk Codes | R34 - Causes burns R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | 3259 |
| Hazard Class | IRRITANT |