| Name | 2,5-Difluoro-4-nitrobenzoic acid |
| Synonyms | 2,5-Difluoro-4-Nitrobenzenecar 2,5-Difluoro-4-nitrobenzoic acid 2,5-DIFLUORO-4-NITROBENZOIC ACID 4-Carboxy-2,5-difluoronitrobenzene Benzoic acid, 2,5-difluoro-4-nitro- 2,5-Difluoro-4-nitrobenzenecarboxylic 2,5-Difluoro-4-nitrobenzenecarboxylicaci 2,5-DIFLUORO-4-NITROBENZENECARBOXYLIC ACID |
| CAS | 116465-48-6 |
| InChI | InChI=1/C7H3F2NO4/c8-4-2-6(10(13)14)5(9)1-3(4)7(11)12/h1-2H,(H,11,12) |
| Molecular Formula | C7H3F2NO4 |
| Molar Mass | 203.1 |
| Density | 1.661±0.06 g/cm3(Predicted) |
| Melting Point | 147-148 |
| Boling Point | 364.8±42.0 °C(Predicted) |
| Flash Point | 174.4°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 5.8E-06mmHg at 25°C |
| Appearance | Solid |
| Color | White to pale green |
| pKa | 2.03±0.13(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.563 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37 - Wear suitable gloves. S60 - This material and its container must be disposed of as hazardous waste. |
| TSCA | No |
| Hazard Class | IRRITANT |
| Use | 2, 5-difluoro-4-nitrobenzoic acid is a carboxylic acid organic substance, which can be used as a pharmaceutical intermediate. |