| Name | N-glycolylneuraminic acid from porcine submaxillary glands |
| Synonyms | Glycolylneuraminic Aci N-glycoylneuraminic acid N-Glycolylneuraminic Acid N-glycoloyl-β-neuraminic acid N-(2-Hydroxyacetyl)-neuraminic Acid N-GLYCOLYLNEURAMINIC ACID FROM PORCINE*SUBMAXILLARY N-glycolylneuraminic acid from porcine submaxillary glands 4-deoxy-4-[(hydroxyacetyl)amino]-D-glycero-D-galacto-oct-2-ulosonic acid 3,5-Dideoxy-5-[(hydroxyacetyl)amino]- D-glycero-D-galacto-2-nonulosonic Acid 3,5-dideoxy-5-[(hydroxyacetyl)amino]-D-glycero-beta-D-galacto-non-2-ulopyranosonic acid |
| CAS | 1113-83-3 |
| InChI | InChI=1/C10H17NO10/c12-1-3(14)6(16)7(17)5(11-4(15)2-13)8(18)9(19)10(20)21/h3,5-8,12-14,16-18H,1-2H2,(H,11,15)(H,20,21)/t3-,5+,6-,7-,8-/m1/s1 |
| Molecular Formula | C11H19NO10 |
| Molar Mass | 325.27 |
| Density | 1.670±0.06 g/cm3(Predicted) |
| Melting Point | 188-190°C |
| Boling Point | 836.8±65.0 °C(Predicted) |
| Flash Point | 472.1°C |
| Solubility | Water (Sparingly) |
| Vapor Presure | 3.24E-34mmHg at 25°C |
| Appearance | White powder |
| Color | White to Off-White |
| BRN | 1716828 |
| pKa | 2.41±0.54(Predicted) |
| Storage Condition | -20°C |
| Refractive Index | 1.62 |
| MDL | MFCD00057551 |
| Use | Regulation of N-hydroxyacetylneuraminic acid biosynthesis in rat liver. |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10 |
| HS Code | 29329990 |
| Biological activity | N-Glycolylneuraminic acid is a non-human sialic acid molecule that can be synthesized in pigs but not in humans. N-Glycolylneuraminic acid acts as a decoy receptor for binding influenza A viruses (IAVs). |
| Uses | Biochemical reagents Regulate the biosynthesis of N-hydroxyacetylneuraminic acid in mouse liver. |