| Name | (R)-( )-2-Benzylamino-1-phenylethanol |
| Synonyms | (R)-2-(BenzyL (1R)-2-(benzylamino)-1-phenylethanol (R)-(-)-2-Benzylamino-1-phenylethanol (R)-(-)-2-Benzylamino-1-Phenylethanol (R)-(-)-2-BENZYLAMINO-1-PHENYLETHANOL (1R)-1-phenyl-2-[(phenylmethyl)amino]ethanol Benzenemethanol, α-[[(phenylmethyl)amino]methyl]-, (αR)- |
| CAS | 107171-75-5 |
| InChI | InChI=1/C15H17NO/c17-15(14-9-5-2-6-10-14)12-16-11-13-7-3-1-4-8-13/h1-10,15-17H,11-12H2/t15-/m0/s1 |
| Molecular Formula | C15H17NO |
| Molar Mass | 227.3 |
| Density | 1.100±0.06 g/cm3(Predicted) |
| Melting Point | 115-118°C(lit.) |
| Boling Point | 375.2±12.0 °C(Predicted) |
| Specific Rotation(α) | -57 º (C=1 IN CHLOROFORM) |
| Flash Point | 127.3°C |
| Vapor Presure | 2.69E-06mmHg at 25°C |
| Appearance | White powder |
| pKa | 13.78±0.20(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.593 |
| MDL | MFCD03427122 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29062990 |