| Name | O-Benzyl-D-serine |
| Synonyms | H-D-Ser(Bzl)-OH H-D-SER(BZL)-OH D-SERINE(BZL)-OH O-Benzyl-D-serine O-BENZYL-D-SERINE D-SERINE BENZYL ETHER (R)-2-AMINO-3-BENZYLOXYPROPIONIC ACID (R)-2-Amino-3-(benzyloxy)propanoic acid (2R)-2-aMino-3-(benzyloxy)propanoic acid (R)-2-Amino-3-Benzyloxypropionic acid,O-Benzyl-D-serine |
| CAS | 10433-52-0 |
| EINECS | 233-916-6 |
| InChI | InChI=1/C10H13NO3/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/m1/s1 |
| Molecular Formula | C10H13NO3 |
| Molar Mass | 195.22 |
| Density | 1.217 |
| Melting Point | ~227°C (dec.) |
| Boling Point | 359.1±37.0 °C(Predicted) |
| Flash Point | 170.9°C |
| Vapor Presure | 8.83E-06mmHg at 25°C |
| BRN | 2649409 |
| pKa | 2.10±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.56 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |