| Name | p-Tolunitrile |
| Synonyms | p-Tolunitril p-Tolunitrile p-toluonitrile 4-cyano-toluene P-toluenenitrile para-tolunitrile 4-Methylbenzonitrile p-Methylbenzonitrile nitrilkyselinyp-toluylove 4-Methylbenzenecarbonitrile Nitril kyseliny p-toluylove P-TOLUNITRILE FOR SYNTHESIS 50 ML P-TOLUNITRILE FOR SYNTHESIS 250 ML |
| CAS | 104-85-8 |
| EINECS | 203-244-8 |
| InChI | InChI=1/C8H7N/c1-7-2-4-8(6-9)5-3-7/h2-5H,1H3 |
| InChIKey | VCZNNAKNUVJVGX-UHFFFAOYSA-N |
| Molecular Formula | C8H7N |
| Molar Mass | 117.15 |
| Density | 0.981g/mLat 25°C(lit.) |
| Melting Point | 26-28°C(lit.) |
| Boling Point | 103-106°C20mm Hg(lit.) |
| Flash Point | 185°F |
| Solubility | alcohol: very soluble |
| Vapor Presure | 0.126mmHg at 25°C |
| Appearance | Viscous Liquid |
| Specific Gravity | 0.981 |
| Color | Clear |
| Exposure Limit | NIOSH: IDLH 25 mg/m3 |
| Merck | 14,9538 |
| BRN | 507386 |
| Storage Condition | Store below +30°C. |
| Stability | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Refractive Index | 1.5285-1.5305 |
| Physical and Chemical Properties | Colorless transparent liquid or crystal, has certain toxicity, flammable, avoid contact with the skin. The boiling point is 217.6 ℃, the relative density is 0.981, and the melting point is 29.5 ℃. |
| Use | Used as pharmaceutical and dye intermediates |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R43 - May cause sensitization by skin contact R36/38 - Irritating to eyes and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37 - Wear suitable protective clothing and gloves. S37 - Wear suitable gloves. S36 - Wear suitable protective clothing. |
| WGK Germany | 2 |
| RTECS | XV0700000 |
| TSCA | Yes |
| HS Code | 29269095 |
| Hazard Note | Irritant |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | for pharmaceutical and dye intermediates |
| category | toxic substances |
| toxicity grade | poisoning |
| Acute toxicity | oral-rat LD50: 3800 mg/kg |
| stimulation data | Skin-rabbits 500 mg/24 h mild; eye-rabbit 500 mg/24 h mild |
| flammability hazard characteristics | open flame flammable; Highly toxic nitrile-containing gas emitted by heat |
| storage and transportation characteristics | The warehouse is ventilated and dried at low temperature; Separate from food, oxidant and acid |
| fire extinguishing agent | water, foam, dry powder, carbon dioxide, sand |