| Name | 2-Diethylaminoethyl hexanoate |
| Synonyms | DA-6 DIETHYLAMIMOETHYLHEXANOTE Diethl aminoethyl hexanoate Diethyl aminoethyl hexanoate DIETHYL AMINOETHYL HEXANOATE 2-DIETHYLAMINOETHYL HEXANOATE 2-Diethylaminoethyl hexanoate 2-(Diethylamino)ethyl caproate Diethl aminoethyl hexanoate (DA-6) DA-6(Diethyl aminoethyl hexanoate) 2-Diethylaminoethyl hexanoate(DA-6) Hexanoic acid 2-(diethylamino)ethyl ester HEXANOIC,2-(DIETHYLAMINO)ETHYLESTERCITRATE |
| CAS | 10369-83-2 |
| EINECS | 600-474-4 |
| InChI | InChI=1/C12H25NO2/c1-4-7-8-9-12(14)15-11-10-13(5-2)6-3/h4-11H2,1-3H3 |
| Molecular Formula | C12H25NO2 |
| Molar Mass | 215.33 |
| Density | 0.907 |
| Boling Point | 277 °C |
| Flash Point | 87.5 °C |
| Solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| Appearance | Bright yellow crystal |
| Color | Off-White |
| pKa | 9.25±0.25(Predicted) |
| Storage Condition | Refrigerator |
| Refractive Index | 1.444 |
| MDL | MFCD12827534 |
| Reference Show more | 1. Sun Xiaohui, Li Chengliang, Chen Jianqiu, et al. Effects of Different Amine Fresh Ester (DA-6) Concentrations and Application Methods on Spinach Growth [J]. Northern Horticultural 2017(13):122-128. |
| application | amine fresh ester, chemical name is diethylaminoethanol hexanoate (diethyl aminoethyl hexanoate, DA-6), is a new type of plant growth regulator, It has the advantages of safety, non-toxicity and easy to use, and can improve crop growth, increase yield and improve crop food quality. It can increase the activity of plant peroxidase and nitrate reductase, increase the content of chlorophyll, accelerate the photosynthetic rate, promote the division and elongation of plant cells, promote the development of root system, and regulate the balance of nutrients in the body. Amine fresh ester can increase the content of chlorophyll, protein, nucleic acid and photosynthetic rate in the plant, increase the activity of peroxidase and nitrate reductase, promote the carbon and nitrogen metabolism of the plant, and enhance the absorption of water and fertilizer and dry matter of the plant Accumulation, regulate the water balance in the body, enhance the disease resistance, drought resistance, and cold resistance of crops and fruit trees; delay plant aging, promote early maturity of crops, increase production, and improve crop quality; so as to increase production and increase quality. |
| use | is a plant growth regulator used to regulate the growth of cabbage |