| Name | 4-Methoxyindole-2-carboxylic acid |
| Synonyms | AKOS JY2082663 IFLAB-BB F2137-0008 4-METHOXYINDOLE-2-CARBOXYLIC ACID 4-METHOXY-2-INDOLECARBOXYLIC ACID 4-Methoxyindole-2-carboxylic acid 4-Methoxy-1H-indol-2-carboxylic acid 4-METHOXY-1H-INDOLE-2-CARBOXYLIC ACID 4-Methoxy-1H-indole-2-carboxylic acid 4-methoxy-1H-indole-2-carboxylic acid 1H-Indole-2-carboxylic acid, 4-methoxy- |
| CAS | 103260-65-7 |
| EINECS | 607-884-2 |
| InChI | InChI=1/C10H9NO3/c1-14-9-4-2-3-7-6(9)5-8(11-7)10(12)13/h2-5,11H,1H3,(H,12,13) |
| Molecular Formula | C10H9NO3 |
| Molar Mass | 191.18 |
| Density | 1.381±0.06 g/cm3(Predicted) |
| Melting Point | 234-235 °C |
| Boling Point | 447.6±25.0 °C(Predicted) |
| Flash Point | 224.5°C |
| Vapor Presure | 8.54E-09mmHg at 25°C |
| pKa | 4.52±0.30(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.677 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| Hazard Class | IRRITANT |