| Name | 4-Amino-6-chloro-2-methylmercaptopyrimidine |
| Synonyms | U 8342 6-CHLORO-2-(METHYLTHIO)PYRIMIDIN-4-AMINE 4-Amino-6-chloro-2-(methylthio)pyrimidine 4-AMINO-6-CHLORO-2-(METHYLTHIO)PYRIMIDINE 4-Pyrimidinamine, 6-chloro-2-(methylthio)- 4-AMINO-6-CHLORO-2-METHYLMERCAPTOPYRIMIDINE 4-Amino-6-chloro-2-methylmercaptopyrimidine 6-AMINO-4-CHLORO-2-METHYLMERCAPTOPYRIMIDINE 6-Chloro-2-(methylsulfanyl)-4-pyrimidinylamine 2-METHYLMERCAPTO-4-AMINO-AMINO-6-CHLOROPYRIMIDINE |
| CAS | 1005-38-5 |
| EINECS | 213-734-3 |
| InChI | InChI=1/C5H6ClN3S/c1-10-5-8-3(6)2-4(7)9-5/h2H,1H3,(H2,7,8,9) |
| InChIKey | ISUXMAHVLFRZQU-UHFFFAOYSA-N |
| Molecular Formula | C5H6ClN3S |
| Molar Mass | 175.64 |
| Density | 1.395 (estimate) |
| Melting Point | 130-132 °C (lit.) |
| Boling Point | 338.7±22.0 °C(Predicted) |
| Flash Point | 158.6°C |
| Vapor Presure | 9.64E-05mmHg at 25°C |
| Appearance | Crystalline Powder |
| Color | Off-white to beige or yellow |
| pKa | 1.11±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.6100 (estimate) |
| MDL | MFCD00006088 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| HS Code | 29335990 |
| Use | 4-amino-6-chloro-2-methylthiopyrimidine is a halogenated heterocyclic ring, Is a useful synthetic intermediate. |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |