1003709-67-8 - Names and Identifiers
Name | 2,3,5-Trifluoro-4-methoxybenzoic acid
|
Synonyms | 2,3,5-Trifluoro-4-methoxybenzoic acid 4-Methoxy-2,3,5-Trifluorobenzoic acid 4-METHOXY-2,3,5-TRIFLUOROBENZOIC ACID Benzoic acid, 2,3,5-trifluoro-4-methoxy-
|
CAS | 1003709-67-8
|
InChI | InChI=1S/C8H5F3O3/c1-14-7-4(9)2-3(8(12)13)5(10)6(7)11/h2H,1H3,(H,12,13) |
1003709-67-8 - Physico-chemical Properties
Molecular Formula | C8H5F3O3
|
Molar Mass | 206.12 |
Density | 1.487±0.06 g/cm3(Predicted) |
Boling Point | 267.3±35.0 °C(Predicted) |
pKa | 2.86±0.10(Predicted) |
Storage Condition | 2-8°C |
1003709-67-8 - Introduction
4-Methoxy-2, 3,5-trifluorobenzoic acid is an organic compound whose chemical formula is C9H7F3O3. The following is a description of the properties, uses, preparation and safety information of the compound:
Nature:
1. Appearance: 4-methoxy-2, 3,5-trifluorobenzoic acid is a colorless crystal or a white powdery solid.
2. melting point: about 130-132 degrees Celsius.
3. Solubility: Soluble in organic solvents such as ethanol, ether and chloroform.
Use:
1. Chemical synthesis: This compound is commonly used as a raw material or intermediate in organic synthesis.
2. pesticide: 4-methoxy -2,3,5-trifluorobenzoic acid is also one of the important components of some pesticides.
Preparation Method:
Generally, 4-methoxy-2, 3,5-trifluorobenzoic acid can be synthesized by reacting p-methoxybenzoic acid and hydrogen fluoride under appropriate conditions.
Safety Information:
1.4-Methoxy-2, 3,5-trifluorobenzoic acid should be avoided from inhalation, swallowing or contact with skin and eyes.
2. When using or handling the compound, wear necessary personal protective equipment such as respiratory protection, chemical protective gloves and goggles.
3. should be stored away from the fire, keep in a dry, cool, well-ventilated place, and with combustible items stored separately.
4. in case of accidental leakage or contact, take appropriate emergency measures immediately and consult a doctor for help.
Last Update:2024-04-10 22:29:15