| Name | pyrene-1-butyric acid |
| Synonyms | NSC 30833 1-Pyrenebutyrate pyrene-1-butyric acid Pyrene-1-butyric acid 1-Pyrenebutanoic acid Pyrene-3-butyric acid 1-Pyrenylbutyric acid Pyrene-3-butyric acid. 4-(Pyren-1-yl)butyric acid 4-(pyren-1-yl)butanoic acid 2-(pyren-1-yl)butanoic acid 4-(Pyrene-3-yl)butanoic acid 4-(Pyrene-1-yl)butanoic acid gamma-(3-Pyrenyl)butyric acid 1-PYRENEBUTYRIC ACID, FOR FLUORESCENCE |
| CAS | 3443-45-6 |
| EINECS | 222-354-7 |
| InChI | InChI=1/C20H16O2/c1-2-15(20(21)22)16-10-8-14-7-6-12-4-3-5-13-9-11-17(16)19(14)18(12)13/h3-11,15H,2H2,1H3,(H,21,22) |
| Molecular Formula | C20H16O2 |
| Molar Mass | 288.34 |
| Density | 1.1742 (rough estimate) |
| Melting Point | 184-186 °C (lit.) |
| Boling Point | 370.57°C (rough estimate) |
| Flash Point | 396.714°C |
| Water Solubility | Partially soluble in water. |
| Solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | Crystalline Powder |
| Color | Pale yellow or yellow-beige |
| BRN | 2140554 |
| pKa | 4.76±0.10(Predicted) |
| Storage Condition | Store below +30°C. |
| Refractive Index | 1.4800 (estimate) |
| MDL | MFCD00004141 |
| Use | Fluorescent probe. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R50 - Very Toxic to aquatic organisms |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S61 - Avoid release to the environment. Refer to special instructions / safety data sheets. |
| UN IDs | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2916 39 90 |
| Reference Show more | 1. [IF=6.707] Zhiguo Lv et al."Py-COOH modified g-C3N4 nanosheets with enhanced visible-light photocatalytic H2 production."Appl Surf Sci. 2020 Feb;504:144486 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | fluorescent probe. |