1-METHYL-1,4-DIAZEPAN-5-ONE - Names and Identifiers
| Name | 1-methyl-1,4-diazepan-5-one
|
| Synonyms | 1-Methyl-1,4-diazepan-5-one 1-methyl-1,4-diazepan-5-one 1-METHYL-5-HOMOPIPERAZINONE 2,5-Diaza-5-methylcycloheptanone 5H-1,4-Diazepin-5-one,hexahydro-1-Methyl- 5H-1,4-Diazepin-5-one, hexahydro-1-methyl-
|
| CAS | 5441-40-7
|
| InChI | InChI=1/C6H12N2O/c1-8-4-2-6(9)7-3-5-8/h2-5H2,1H3,(H,7,9) |
1-METHYL-1,4-DIAZEPAN-5-ONE - Physico-chemical Properties
| Molecular Formula | C6H12N2O
|
| Molar Mass | 128.17 |
| Density | 1.003±0.06 g/cm3(Predicted) |
| Melting Point | 83-84 °C |
| Boling Point | 125-130 °C(Press: 1.2 Torr) |
| Flash Point | 119.993°C |
| Vapor Presure | 0.005mmHg at 25°C |
| pKa | 16.24±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.457 |
1-METHYL-1,4-DIAZEPAN-5-ONE - Risk and Safety
| Safety Description | 24/25 - Avoid contact with skin and eyes.
|
| HS Code | 29339900 |
1-METHYL-1,4-DIAZEPAN-5-ONE - Introduction
1-methyl-1,4-diazepan-5-one(1-methyl-1,4-diazepan-5-one) is an organic compound. The following is a description of its nature, use, preparation and safety information:
Nature:
-Appearance: 1-methyl-1,4-diazepan-5-one is a colorless liquid or solid.
-Solubility: It can be dissolved in organic solvents, such as ethanol, dimethyl sulfoxide and ether.
-Melting point and boiling point: The melting point is usually between 25°C and 30°C. Its boiling point is between 220°C and 225°C.
Use:
- 1-methyl-1,4-diazepan-5-one is widely used in the field of drug synthesis and organic synthesis.
-It can be used as an intermediate for the synthesis of various drugs, such as antihypertensive drugs, antipsychotic drugs, etc.
Preparation Method:
The preparation method of -1-methyl-1,4-diazepan-5-one is relatively simple, usually by reacting 1,4-diazepan-5-one with methyl bromide.
-Reaction conditions generally require the presence of an organic solvent, such as chloroform or acetone.
-The reaction is usually carried out at room temperature and uses a basic or acid catalyst.
Safety Information:
- 1-methyl-1,4-diazepan-5-one is generally considered to be relatively safe.
-However, like all chemicals, use should follow appropriate laboratory operations and personal protective measures.
-It may be irritating to the eyes, skin and respiratory tract, please avoid direct contact.
-When using, storing and handling, please follow the appropriate safety procedures and properly dispose of waste.
Last Update:2024-04-09 20:45:29