| Name | 1-Ethyl-3-methylimidazolium chloride |
| Synonyms | Basionics? ST 80 1-ethyl-3-methyl-1H-imidazol-3-ium 1-Ethyl-3-methylimidazolium chloride 1-Ethyl-3-methyl-1H-imidazolium chloride 1-Ethyl-3-methylimidazolium chloride(EMIC) 1H-Imidazolium,3-ethyl-1-methyl-, chloride 1-ethyl-3-methyl-1H-imidazol-3-ium chloride 1-ethyl-3-Methyl-1H-iMidazol-3-iuM chloride |
| CAS | 65039-09-0 |
| EINECS | 613-739-4 |
| InChI | InChI=1/C6H11N2.ClH/c1-3-8-5-4-7(2)6-8;/h4-6H,3H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BMQZYMYBQZGEEY-UHFFFAOYSA-M |
| Molecular Formula | C6H11ClN2 |
| Molar Mass | 146.62 |
| Density | 1.435 g/cm3 |
| Melting Point | 77-79°C(lit.) |
| Flash Point | 186°C |
| Water Solubility | Soluble in water. |
| Vapor Presure | 0Pa at 20-50℃ |
| Appearance | Bright brown liquid |
| Color | Pale yellow |
| BRN | 5163190 |
| Storage Condition | Store below +30°C. |
| Stability | Stable. Very hygroscopic. Incompatible with strong oxidizing agents. |
| Sensitive | Hygroscopic |
| MDL | MFCD00074843 |
| Use | For molten salt |
| Risk Codes | R36/38 - Irritating to eyes and skin. R51/53 - Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. R36/37/38 - Irritating to eyes, respiratory system and skin. R25 - Toxic if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S57 - Use appropriate container to avoid environmental contamination. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S37/39 - Wear suitable gloves and eye/face protection S29 - Do not empty into drains. |
| UN IDs | 2811 |
| WGK Germany | 2 |
| FLUKA BRAND F CODES | 3-10 |
| TSCA | Yes |
| HS Code | 2933 29 90 |
| LogP | -2.6 at 23℃ and pH6.6 |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | for ionic liquids for molten salts |