| Name | 1-chloro-2-methylbutane |
| Synonyms | Chloromethylbutane 2-methylbutylchloride 1-CHLORO-2-METHYLBUTANE 1-chloro-2-methyl-butan 1-chloro-2-methylbutane butane,1-chloro-2-methyl- Butane, 1-chloro-2-methyl- 1-chloro-(2RS)-methylbutane Butane,1-chloro-2-methyl(DL) Butane,1-chloro-2-methyl-,(±)- |
| CAS | 616-13-7 |
| EINECS | 210-466-9 |
| InChI | InChI=1/C5H11Cl/c1-3-5(2)4-6/h5H,3-4H2,1-2H3 |
| Molecular Formula | C5H11Cl |
| Molar Mass | 106.59 |
| Density | 0.886 g/mL at 25 °C (lit.) |
| Melting Point | -104°C |
| Boling Point | 100 °C/750 mmHg (lit.) |
| Flash Point | 32°F |
| Vapor Presure | 46.2mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Light yellow to Light orange |
| Storage Condition | Room Temprature |
| Refractive Index | n20/D 1.412(lit.) |
| MDL | MFCD00039366 |
| Hazard Symbols | F - Flammable![]() |
| Risk Codes | 11 - Highly Flammable |
| Safety Description | S16 - Keep away from sources of ignition. S33 - Take precautionary measures against static discharges. |
| UN IDs | UN 1107 3/PG 2 |
| WGK Germany | 3 |
| Hazard Class | 3 |
| Packing Group | II |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |