| Name | 1-Bromo-2-methoxynaphthalene |
| Synonyms | 1-Bromo-2-methoxynapthalene 2-Methoxy-1-naphtyl bromide 1-Bromo-2-methoxynaphthalene 1-BROMO-2-METHOXYNAPHTHALENE Naphthalene, 1-broMo-2-Methoxy- |
| CAS | 3401-47-6 |
| EINECS | 222-272-1 |
| InChI | InChI=1/C11H9BrO/c1-13-10-7-6-8-4-2-3-5-9(8)11(10)12/h2-7H,1H3 |
| Molecular Formula | C11H9BrO |
| Molar Mass | 237.09 |
| Density | 1.447±0.06 g/cm3(Predicted) |
| Melting Point | 80-83°C |
| Boling Point | 190-192 °C(Press: 22 Torr) |
| Flash Point | 132.9°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 0.000641mmHg at 25°C |
| Appearance | Solid |
| Color | White to Light yellow |
| BRN | 2045600 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.632 |
| MDL | MFCD00055374 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29093090 |
| Uses | 1-bromo-2-methoxynaphthalene is a hydrocarbon derivative that can be used as an organic reagent. |