| Name | N-Acetylpiperazine |
| Synonyms | 1-AcetyL AKOS BB-5737 acetylpiperazine N-Acetylpiperazine N-ACETYLPIPERAZINE 1-Acetylpiperazine 1-ACETYLPIPERAZINE N-Acetyl piperazine 4-acetylpiperazin-1-ium 1-PIPERAZIN-1-YL-ETHANONE 1-(piperidin-1-yl)ethanone 1-(piperazin-1-yl)ethanone |
| CAS | 13889-98-0 |
| EINECS | 237-659-0 |
| InChI | InChI=1/C6H12N2O/c1-6(9)8-4-2-7-3-5-8/h7H,2-5H2,1H3/p+1 |
| Molecular Formula | C6H12N2O |
| Molar Mass | 128.17 |
| Density | 1.0754 (rough estimate) |
| Melting Point | 31-34 °C (lit.) |
| Boling Point | 127 °C |
| Flash Point | >230°F |
| Water Solubility | Soluble in water 210 g/L (20°C). |
| Solubility | methanol: soluble1g/10 mL, clear, colorless to faintly greenish-yellow |
| Vapor Presure | 0.0142mmHg at 25°C |
| Appearance | Crystallization |
| Color | Clear light yellow |
| BRN | 112220 |
| pKa | 8.50±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | Hygroscopic |
| Refractive Index | 1.4880 (estimate) |
| MDL | MFCD00058676 |
| Physical and Chemical Properties | Crystallization (aqueous ethanol). Melting point 52 ℃, flash point> 110 ℃. |
| Use | intermediates of prenidothiazole. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/38 - Irritating to eyes and skin. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 3-10-34 |
| HS Code | 29339900 |
| Hazard Note | Irritant |
| chemical properties | crystallization (ethanol aqueous solution). Melting point 52 ℃, flash point> 110 ℃. |
| use | intermediates of piperazothiazole. |
| production method | It can be prepared by acetylation of piperazine hexahydrate with acetic anhydride and acetic acid. |