| Name | 1-Bromomethyl-Naphthalene |
| Synonyms | 1-(Bromomethyl)napht 1-Naphtylmethyl bromide (1-Naphtyl)bromomethane 1-(Bromomthy)Naphthalene 1-Bromomethylnaphthalene 1-Bromomethyl-Naphthalene 1-Bromomethyl naphthalene 1-(Bromomethy)naphthalene 1-BROMOMETHYL NAPHTHALENE 1-(Bromomethyl)naphthalene Naphthalene, 1-(bromomethyl)- |
| CAS | 3163-27-7 |
| EINECS | 801-817-2 |
| InChI | InChI=1/C11H9Br/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2 |
| Molecular Formula | C11H9Br |
| Molar Mass | 221.09 |
| Density | 1.44 |
| Melting Point | 52-55°C |
| Boling Point | 213°C/100mmHg |
| Flash Point | 151.8°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 0.000422mmHg at 25°C |
| Appearance | White solid |
| Color | Off-white |
| Maximum wavelength(λmax) | ['292nm(Cyclohexane)(lit.)'] |
| Storage Condition | Inert atmosphere,2-8°C |
| Refractive Index | 1.6600 |
| MDL | MFCD00010804 |
| Physical and Chemical Properties | White solid powder. |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 3261 |
| HS Code | 29036990 |
| Hazard Class | 8 |
| Packing Group | II |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| Preparation | 1-bromomethylnaphthalene is a chemical substance, which can be produced by 1-methylnaphthalene via N-bromosuccinimide (NBS) photobromination reaction. |