| Name | 1-(2-methylphenyl)ethanamine |
| Synonyms | LogP 1-o-Tolylethylamine 1-(o-Tolyl)ethanaMine 1-(2-methylphenyl)ethanamine 1-(2-Methylphenyl)ethylamine 1-(2-Methylphenyl)ethanamine Benzenemethanamine, α,2-dimethyl- BenzeneMethanaMine, .alpha.,2-diMethyl- |
| CAS | 42142-17-6 |
| InChI | InChI=1/C9H13N/c1-7-5-3-4-6-9(7)8(2)10/h3-6,8H,10H2,1-2H3 |
| Molecular Formula | C9H13N |
| Molar Mass | 135.21 |
| Density | 0.9736 g/cm3 |
| Boling Point | 55-57 °C(Press: 1 Torr) |
| Flash Point | 84.6°C |
| Vapor Presure | 0.204mmHg at 25°C |
| pKa | 9.22±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.53 |
| Uses | 1-(o-tolyl) ethylamine is a useful compound that can be used to synthesize and screen macamides analogs as TNF-α inhibitors. |