| Name | 1,3-Diisopropylbenzene |
| Synonyms | HSDB 5325 AI3-08224 BRN 1905828 m-Diisopropylbenzol 3-Diisopropylbenzene m-Diisopropylbenzene 1,3-Diisopropylbenzene Benzene, m-diisopropyl- 1,3-di(propan-2-yl)benzene 1,3-bis(1-methylethyl)-benzen 1,3-Bis(1-methylethyl)benzene 1,3-bis(1-methylethyl)benzene 1,3-bis(1-methylethyl)-Benzene Benzene, 1,3-di-(1-methylethyl) Benzene, 1,3-bis(1-methylethyl)- |
| CAS | 99-62-7 |
| EINECS | 202-773-1 |
| InChI | InChI=1/C12H18/c1-9(2)11-6-5-7-12(8-11)10(3)4/h5-10H,1-4H3 |
| Molecular Formula | C12H18 |
| Molar Mass | 162.27 |
| Density | 0.856 g/mL at 25 °C (lit.) |
| Melting Point | -63 °C (lit.) |
| Boling Point | 203 °C (lit.) |
| Flash Point | 170°F |
| Water Solubility | Soluble in water 4.33 mg/L at 25°C. |
| Vapor Presure | 9.97Pa at 20℃ |
| Appearance | clear liquid |
| Color | Colorless to Almost colorless |
| BRN | 1905828 |
| Refractive Index | n20/D 1.488(lit.) |
| Risk Codes | 33 - Danger of cumulative effects |
| Safety Description | S24/25 - Avoid contact with skin and eyes. |
| UN IDs | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | CZ6334000 |
| TSCA | Yes |
| Hazard Class | 9 |
| Packing Group | III |
| LogP | 5.13 at 25℃ |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| spontaneous combustion temperature | 840 ° F. |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |