| Name | (S)-(+)-Neomenthyldiphenylphosphine (S)-NMDPP |
| Synonyms | (+)-NMDPP (S)-NMDPP (S)-(+)-NMDPP neomenthyldiphenylphosphine (S)-(+)-Neomenthyldiphenylphosphine (S)-(+)-NEOMENTHYLDIPHENYLPHOSPHINE (1S,2S,5R)-(+)-NEOMENTHYLDIPHENYLPHOSPHINE (S)-(+)-Neomenthyldiphenylphosphine (S)-NMDPP [(1S,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl](diphenyl)phosphane |
| CAS | 43077-29-8 |
| InChI | InChI=1/C22H29P/c1-17(2)21-15-14-18(3)16-22(21)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,17-18,21-22H,14-16H2,1-3H3/t18-,21+,22+/m1/s1 |
| Molecular Formula | C22H29P |
| Molar Mass | 324.44 |
| Melting Point | 95-99 °C |
| Boling Point | 414.7±14.0 °C(Predicted) |
| Specific Rotation(α) | +95.5° (c 1.26, CH2Cl2) |
| Flash Point | 216.1°C |
| Vapor Presure | 1.05E-06mmHg at 25°C |
| Appearance | crystal |
| Color | white |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Sensitive | air sensitive |
| MDL | MFCD00013415 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/37 - |
| HS Code | 29310099 |