(R)-TOL-BINAP - Names and Identifiers
| Name | (S)-(-)-2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl
|
| Synonyms | (S)-TolBINAP (R)-TOL-BINAP (S)-TOL-BINAP (S)-(-)-TolBINAP BisdiptolylphosphinobinaphthylSTolBI (R)-(+)-2,2'-BIS(DI-P-TOLYLPHOSPHINO)1,1-BINAPHTHYL (S)-(-)-2,2'-BIS(DI-P-TOLYLPHOSPHINO)-1,1'-BINAPHTHYL (S)-(-)-2,2'-Bis(di-p-tolylphosphino)-1,1'-binaphthyl 1,1'-binaphthalene-2,2'-diylbis[bis(4-methylphenyl)phosphane] (S)-(-)-2,2''-BIS(DI-P-TOLYLPHOSPHINO)-1,1''-BINAPHTHYL (S)-TOL-BINAP
|
| CAS | 100165-88-6
|
| EINECS | 1312995-182-4 |
| InChI | InChI=1/C48H40P2/c1-33-13-23-39(24-14-33)49(40-25-15-34(2)16-26-40)45-31-21-37-9-5-7-11-43(37)47(45)48-44-12-8-6-10-38(44)22-32-46(48)50(41-27-17-35(3)18-28-41)42-29-19-36(4)20-30-42/h5-32H,1-4H3 |
| InChIKey | IOPQYDKQISFMJI-UHFFFAOYSA-N |
(R)-TOL-BINAP - Physico-chemical Properties
| Molecular Formula | C48 H40 P2
|
| Molar Mass | 678.78 |
| Melting Point | 252-256°C |
| Boling Point | 754.4±60.0 °C(Predicted) |
| Specific Rotation(α) | -160° (c 0.5, C6H6) |
| Flash Point | 438.8°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 9.63E-22mmHg at 25°C |
| Appearance | Powder |
| Color | White |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | `sensitive` to humidity and air |
| MDL | MFCD01311709 |
(R)-TOL-BINAP - Risk and Safety
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection.
|
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29333990 |
(R)-TOL-BINAP - Introduction
(S)-(-)-2,2-bis (di-p-tolylphosphine)-1,1-dibinaphthyl is a chiral organic compound, also known as (-)-BINAP. Its properties are as follows:
1. Appearance: colorless crystal or white powder.
2. Melting point: 170-172°C.
3. Solubility: Soluble in organic solvents such as ethanol, chloroform, dichloromethane, etc.
4. Chemical properties:(S)-(-)-BINAP can form complexes and be used as chiral catalysts.
(S)-(-)-BINAP has many applications in organic synthesis:
1. Chiral catalyst:(S)-(-)-BINAP is widely used in metal-catalyzed asymmetric synthesis reactions, such as asymmetric hydrogenation, reduction, etherification, amination and other reactions.
2. Chiral ligand: it can form chiral complexes with transition metals for asymmetric catalytic reactions, such as the asymmetric catalytic hydrogenation of acetic acid in the synthesis of sucrose.
The method for preparing (S)-(-)-2,2-bis (di-p-tolylphosphine)-1,1-dibinaphthalene is as follows:
1. (S)-(-)-BINAP with high purity can be prepared by reacting 2,2 '-phenyldiphosphinylmethane with benzaldehyde through reduction and separation.
Safety Information:
(S)-(-)-BINAP is relatively stable, but safety operation should still be paid attention. Avoid contact with eyes, skin and taking. Wear appropriate protective equipment, such as lab gloves and goggles. At the same time, when storing (S)-(-)-BINAP, avoid contact between fire and oxidant. In case of leakage, anti-spray device shall be used to remove the leakage. Any waste needs to be disposed of properly.
Last Update:2024-04-09 21:11:58