(3-Chlorophenyl)oxirane
(3-Chlorophenyl)oxirane
CAS: 53631-04-2
Molecular Formula: C8H7ClO
(3-Chlorophenyl)oxirane - Names and Identifiers
| Name | (3-Chlorophenyl)oxirane |
| Synonyms | (3-chlorophenyl)oxirane (3-Chlorophenyl)oxirane 2-(3-Chlorophenyl)oxirane |
| CAS | 53631-04-2 |
| InChI | InChI=1/C8H7ClO/c9-7-3-1-2-6(4-7)8-5-10-8/h1-4,8H,5H2 |
(3-Chlorophenyl)oxirane - Physico-chemical Properties
| Molecular Formula | C8H7ClO |
| Molar Mass | 154.59 |
| Density | 1.283g/cm3 |
| Boling Point | 229.4°C at 760 mmHg |
| Flash Point | 97.6°C |
| Vapor Presure | 0.105mmHg at 25°C |
| Refractive Index | 1.581 |
(3-Chlorophenyl)oxirane - Introduction
(3-Chlorophenyl)oxirane, the molecular formula is C8H7ClO, and the structural formula is ClC6H4CH2OCH2. The following is a description of its nature, use, formulation and safety information:
Nature:
1. Appearance:(3-Chlorophenyl)oxirane is a colorless to pale yellow liquid.
2. Boiling point: Its boiling point is 156-158 ℃.
3. Density: Its density is 1.23 g/mL.
4. Stability:(3-Chlorophenyl)oxirane is relatively stable at room temperature, but ring-opening reactions may occur under high temperature, high pressure or the presence of organic acids.
Use:
1. Chemical synthesis: As an important organic synthesis intermediate, it is often used to construct the skeleton of organic molecules in organic synthesis reactions.
2. pesticides:(3-Chlorophenyl)oxirane can also be used as raw materials for pesticides.
Preparation Method:
A method for preparing (3-Chlorophenyl)oxirane is to subject them to an epoxidation reaction by reacting 3-chlorophenylethanol with an excess amount of thionyl chloride, followed by adding ethylene oxide to the reaction system to maintain the temperature and pressure.
Safety Information:
1. Toxicity:(3-Chlorophenyl)oxirane is an organic compound that may be toxic to the human body. Exposure to high concentrations of it may cause irritation, while long-term exposure may cause damage to the central nervous system and reproductive system.
2. protective measures: in the process of operation, should wear appropriate protective equipment, such as protective clothing, protective glasses and gloves, to avoid skin contact and inhalation. It should be operated in a well-ventilated area, and the conditions that may cause fire should be strictly controlled.
Nature:
1. Appearance:(3-Chlorophenyl)oxirane is a colorless to pale yellow liquid.
2. Boiling point: Its boiling point is 156-158 ℃.
3. Density: Its density is 1.23 g/mL.
4. Stability:(3-Chlorophenyl)oxirane is relatively stable at room temperature, but ring-opening reactions may occur under high temperature, high pressure or the presence of organic acids.
Use:
1. Chemical synthesis: As an important organic synthesis intermediate, it is often used to construct the skeleton of organic molecules in organic synthesis reactions.
2. pesticides:(3-Chlorophenyl)oxirane can also be used as raw materials for pesticides.
Preparation Method:
A method for preparing (3-Chlorophenyl)oxirane is to subject them to an epoxidation reaction by reacting 3-chlorophenylethanol with an excess amount of thionyl chloride, followed by adding ethylene oxide to the reaction system to maintain the temperature and pressure.
Safety Information:
1. Toxicity:(3-Chlorophenyl)oxirane is an organic compound that may be toxic to the human body. Exposure to high concentrations of it may cause irritation, while long-term exposure may cause damage to the central nervous system and reproductive system.
2. protective measures: in the process of operation, should wear appropriate protective equipment, such as protective clothing, protective glasses and gloves, to avoid skin contact and inhalation. It should be operated in a well-ventilated area, and the conditions that may cause fire should be strictly controlled.
Last Update：2024-04-10 22:29:15
