| Name | (S)-(-)-2-(diphenylmethyl)pyrrolidine |
| Synonyms | (S)-2-Benzhydrylpyrrolidine (2S)-2-Benzhydrylpyrrolidine 2-(diphenylmethyl)pyrrolidine (S)-2-Diphenylmethylpyrrolidine (S)-2-DIPHENYLMETHYLPYRROLIDINE (2S)-2-(diphenylmethyl)pyrrolidine (2S)-2-(diphenylmethyl)pyrrolidinium (S)-(-)-2-(diphenylmethyl)pyrrolidine (S)-2-(1,1-DiphenylMethyl)pyrrolidine (S)-(-)-2-(DIPHENYLMETHYL)PYRROLIDINE (S)-(+)-2-(Diphenylmethyl)pyrrolidine |
| CAS | 119237-64-8 |
| InChI | InChI=1/C17H19N/c1-3-8-14(9-4-1)17(16-12-7-13-18-16)15-10-5-2-6-11-15/h1-6,8-11,16-18H,7,12-13H2/p+1/t16-/m0/s1 |
| Molecular Formula | C17H19N |
| Molar Mass | 237.34 |
| Density | 1.062g/mLat 25°C(lit.) |
| Boling Point | 135°C0.01mm Hg(lit.) |
| Flash Point | 109 °C |
| Solubility | Chloroform (Sparingly), Methanol (Slightly) |
| Vapor Presure | 4.64E-05mmHg at 25°C |
| Appearance | Oil |
| Color | Clear colorless to pale yellow |
| pKa | 10.68±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.587(lit.) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Hazard Note | Irritant |
| Use | as a good chiral solvent, it is used to directly determine the enantiomeric composition of chiral carboxylic acids by NMR analysis. |