| Supplier Name | |
| Tel | 0531-83130525 |
| Mobile | |
| sales@yufengpharm.com | |
| Website | |
| Product Name | 2,3,4-Trimethoxybenzaldehyde |
| Synonyms | 2,3,4-TrimethoxybenzaL Trimetazidine Impurity C TriMetazidine EP IMpurity-C 2,3,4-trimethoxy-benzaldehyd 2,3,4-Trimethoxybenzaldehyde 2,3,4-Trimedhoxy Benzaldehyde 2,3,4-Trihydrooxy Benzaldehyde |
| CAS | 2103-57-3 |
| EINECS | 218-271-0 |
| Chemical Formula | C10H12O4 |
| Molecular Weight | 196.2 |
| inchi | InChI=1/C10H12O4/c1-12-8-5-4-7(6-11)9(13-2)10(8)14-3/h4-6H,1-3H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-12-13 20:28:58 |