![]() | |
Supplier Name | MedChemExpress (MCE) |
Contact | sales |
Tel | 609-228-6898 |
Mobile | 609-228-6898 |
sales@medchemexpress.com; tech@medchemexpress.com | |
Website | https://www.medchemexpress.com/ |
Product Name | Huperzine B |
Synonyms | HuperzineB Huperzine B 8,15-Didehydrolycodin-1(18H)-one 12-Methyl-2,3,4,4a,5,6-hexahydro-1H-5,10b-prop[1]eno-1,7-phenanthrolin-8(7H)-one (4aR,5S,10bR)-12-methyl-2,3,4,4a,5,6-hexahydro-1H-5,10b-prop[1]eno-1,7-phenanthrolin-8(7H)-one |
CAS | 103548-82-9 |
EINECS | |
Chemical Formula | C16H20N2O |
Molecular Weight | 256.34 |
inchi | InChI=1/C16H20N2O/c1-10-7-11-8-14-13(4-5-15(19)18-14)16(9-10)12(11)3-2-6-17-16/h4-5,7,11-12,17H,2-3,6,8-9H2,1H3,(H,18,19)/t11-,12+,16-/m0/s1 |
Package | 10 mM * 1 mL;1 mg;5 mg;10 mg;20 mg |
Price | Email to quote |
Descriptions | Huperzine B MedChemExpress (MCE) HY-N2043 98.13% 4°C, sealed storage, away from moisture and light *In solvent : -80°C, 6 months |
Supplier Website | https://www.medchemexpress.com/huperzine-b.html |
Last Update | 2025-05-21 16:50:25 |