Product Name | p-Bromophenoxyacetic acid |
Synonyms | p-BroMophenoxyacetic p-Bromophenoxyacetate 4-BroMophenoxacetic acid p-Bromophenoxyacetic acid 4-Bromophenoxyacetic acid 2-(4-bromophenoxy)acetate (4-Bromophenoxy)acetic acid |
CAS | 1878-91-7 |
EINECS | 217-530-5 |
Chemical Formula | C8H7BrO3 |
Molecular Weight | 231.04 |
inchi | InChI=1/C8H7BrO3/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11) |
Package | 25KG/Drum |
Price | RFQ |
Descriptions | P-bromophenoxyacetic acid (PBPA) is an organic compound with the molecular formula C8H7BrO3. It is a white or colorless crystalline solid with an irritating odor. The chemical structure of para bromophenoxyacetic acid contains a para bromo substituted benzene ring and an oxyacetic acid group. Bromophenoxy acetic acid has a wide range of applications in the chemical industry, mainly reflected in the following aspects: 1. Pesticide: p-bromophenoxyacetic acid is a plant growth regulator that promotes plant growth, increases yield, and is resistant to pests and diseases. It can be used to prepare agricultural chemicals such as herbicides, insecticides, and fungicides. 2. Medicine: Bromophenoxyacetic acid and its derivatives have pharmacological effects in the field of medicine, including anti-inflammatory, analgesic, and anti-tumor effects. It can be used to prepare drugs, such as nonsteroidal anti-inflammatory drugs, anti-tumor drugs, etc. 3. Dyes: p-bromophenoxyacetic acid can be used to prepare dyes, such as azo dyes, acrylic dyes, etc., with good dyeing performance and fastness. 4. Synthetic materials: p-bromophenoxyacetic acid can be used to synthesize other organic compounds, such as spices, seasonings, surfactants, etc. 5. Environmental protection field: p-bromophenoxy acetic acid can be used to treat industrial wastewater, domestic sewage, etc., reduce pollutant concentration, and protect water resources. C8H7BrO3 is an organic compound with a pungent odor. Its molecular structure contains a para brominated benzene ring and an oxyacetic acid group. This compound has a wide range of applications in the chemical industry, especially in industries such as pesticides, pharmaceuticals, and dyes. |
Last Update | 2024-05-16 16:10:34 |