| Supplier Name | |
| Tel | 0519-82337678 |
| Mobile | |
| Fax | |
| whp@star-chem.com | |
| Website |
| Product Name | Ferrocenecarboxylic acid |
| Alias | Ferrocene monocarboxylic acid Ferroncene Monocarboxylic Acid Carboxyferrocene Ferrocene carboxylic acid FCA iron(2+) 5-carboxycyclopenta-1,3-dienide cyclopenta-1,3-dienide (1:1:1) 1,2,3,4,5-cyclopentanepentayl, 1-carboxy-, compd. with 1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1) |
| CAS | 1271-42-7 |
| EINECS | 215-040-6 |
| Chemical Formula | C11H10FeO2 |
| Molecular Weight | 230.044 |
| inchi | InChI=1/C6H5O2.C5H5.Fe/c7-6(8)5-3-1-2-4-5;1-2-4-5-3-1;/h1-4H,(H,7,8);1-5H;/q-1;-5 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2021-12-22 20:55:06 |