Product Name | 2,6-Dihydroxybenzoic acid |
Synonyms | nsc49172 G-RESORCYLIC ACID 2,6-Resorcylic acid 2-Carboxyresorcinol 2,6-dihydroxybenzoate 6-hydroxysalicylicacid gamma-Resorcylic Acid |
CAS | 303-07-1 |
EINECS | 206-134-8 |
Chemical Formula | C7H6O4 |
Molecular Weight | 154.12 |
inchi | InChI=1/C7H6O4/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,8-9H,(H,10,11)/p-1 |
Package | 25KG/Drum |
Price | RFQ |
Descriptions | 2,6-Dihydroxybenzoic acid, also known as γ- Razosin formic acid, is a white crystalline powder that is soluble in acids, ethers, and hot water, with a melting point of 160-165 ℃. 2,6-Dihydroxybenzoic acid has the properties of phenol and acid, and is widely used in agricultural chemistry and industrial chemistry, such as as as the main raw material for synthesizing the highly efficient herbicide KIH-2023, chemical reaction catalyst, photographic brightener, organic synthesis raw material, pharmaceutical intermediate, etc. |
Last Update | 2024-04-27 15:18:05 |