Product Name | 3,5-Difluorophenylboronic acid |
Synonyms | AKOS BRN-0091 RARECHEM AH PB 0167 3,5-Difluorophenylboronic acid 3,5-DIFLUOROPHENYLBORONIC ACID 3,5-DIFLUOROBENZENEBORONIC ACID 3,5-Difluorobenzeneboronic acid (3,5-dimethoxyphenyl)boronic acid |
CAS | 156545-07-2 |
EINECS | 605-060-7 |
Chemical Formula | C6H5BF2O2 |
Molecular Weight | 157.91 |
inchi | InChI=1/C13H11BF2O3/c15-12-10(14(17)18)6-7-11(13(12)16)19-8-9-4-2-1-3-5-9/h1-7,17-18H,8H2 |
Package | 25KG/Drum |
Price | RFQ |
Descriptions | 3,5-Difluorophenylboronic acid is a yellow solid containing fluorophenylboronic acid. The chemical formula is C6H5BF2O2. Fluorophenylboronic acid is a type of organic synthesis, pharmaceutical, and chemical intermediate that is relatively stable in the air, insensitive to moisture, can be stored for a long time, and has high reactivity. The coupling reaction between fluorophenylboronic acid and halogenated aromatic hydrocarbons has good positional and stereoselectivity, and various chemical functional groups do not change during the reaction. The reaction conditions are mild and the yield is high, making it an important pathway for forming C-C bonds |
Last Update | 2024-04-27 15:18:05 |