| Supplier Name | JiangSu 01 Industrial Co., Ltd. |
| Tel | 15105181882 |
| Mobile | 15105181882 |
| mera.z@sunmy.com | |
| Website | http://www.slchem.com |
| Product Name | 3-Methyl-2-nitrobenzoic acid |
| Synonyms | BL-ME-0 3-Methyl-2-nitrobenz 2-Nitro-m-toluic acid 2-NITRO-M-TOLUIC ACID 3-Methyl-2-nitrobenzoic 3-methyl-2-nitrobenzoate 3-METHYL-2-NITROBENZOIC ACID |
| CAS | 5437-38-7 |
| EINECS | 226-610-9 |
| Chemical Formula | C8H7NO4 |
| Molecular Weight | 181.15 |
| inchi | InChI=1/C8H7NO4/c1-5-3-2-4-6(8(10)11)7(5)9(12)13/h2-4H,1H3,(H,10,11)/p-1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |