Isobutyl isothiocyanate Provided by Hefei TNJ Chemical Industry Co.,Ltd.
| Product Name | Isobutyl isothiocyanate |
| Alias | Isothiocyanic acid, isobutyl ester 1-Isothiocyanato-2-methylpropane 2-Methylpropyl isothiocyanate 4-04-00-00653 (Beilstein Handbook Reference) BRN 1740371 EINECS 209-733-2 i-Butyl isothiocyanate |
| CAS | 591-82-2 |
| EINECS | 209-733-2 |
| Chemical Formula | C5H9NS |
| Molecular Weight | 115.197 |
| inchi | InChI=1/C5H9NS/c1-5(2)3-6-4-7/h5H,3H2,1-2H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2021-12-22 20:55:06 |
Supplier Contact
| Supplier Name | Hefei TNJ Chemical Industry Co.,Ltd. |
| Contact | Sophia Zhang |
| Tel | 0086-551-65418679 |
| Mobile | 0086 158 5698 8503 |
| 2885216886 | |
| Fax | 0086-551-65418697 |
| sales@tnjchem.com, info@tnjchem.com | |
| Website | https://www.tnjchem.com |
| 0086 189 4982 3763 | |
| 0086 189 4982 3763 |