3-benzyl-5-(2-hydroxyethyl)-4-methylthiazolium chloride Provided by Hefei TNJ Chemical Industry Co.,Ltd.
| Product Name | 3-benzyl-5-(2-hydroxyethyl)-4-methylthiazolium chloride |
| Alias | thiazolium, 5-(2-hydroxyethyl)-4-methyl-3-(phenylmethyl)- 3-benzyl-5-(2-hydroxyethyl)-4-methyl-1,3-thiazol-3-ium 3-benzyl-5-(2-hydroxyethyl)-4-methyl-1,3-thiazol-3-ium chloride thiazolium, 5-(2-hydroxyethyl)-4-methyl-3-(phenylmethyl)-, hydrochloride |
| CAS | 4568-71-2 |
| EINECS | 224-947-6 |
| Chemical Formula | C13H17ClNOS |
| Molecular Weight | 270.798 |
| inchi | InChI=1/C13H16NOS.ClH/c1-11-13(7-8-15)16-10-14(11)9-12-5-3-2-4-6-12;/h2-6,10,15H,7-9H2,1H3;1H/q+1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2021-12-22 20:55:07 |
Supplier Contact
| Supplier Name | Hefei TNJ Chemical Industry Co.,Ltd. |
| Contact | Sophia Zhang |
| Tel | 0086-551-65418679 |
| Mobile | 0086 158 5698 8503 |
| 2885216886 | |
| Fax | 0086-551-65418697 |
| sales@tnjchem.com, info@tnjchem.com | |
| Website | https://www.tnjchem.com |
| 0086 189 4982 3763 | |
| 0086 189 4982 3763 |