| Supplier Name | Heze Sirloong Chemical Co.,Ltd |
| Tel | 0530-5158668 |
| Mobile | 15153016378 |
| xlhg102@sirloong.com, | |
| Website | http:// www.sirloong.com |
| Product Name | Isobutane |
| Synonyms | R600A R-600a Isobutane ISOBUTANE 2-METHYLPROPANE GEIGER FLOW GAS Isobutane,high purity |
| CAS | 75-28-5 |
| EINECS | 200-857-2 |
| Chemical Formula | C4H10 |
| Molecular Weight | 58.12 |
| inchi | InChI=1/C4H10/c1-4(2)3/h4H,1-3H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |