| Supplier Name | Taixing precise tech co., ltd |
| Tel | 0523-89790018 |
| Mobile | 18136839580 |
| 1406923195@qq.com | |
| Website | http://www.precisechemtech.com |
| Product Name | 1,3,5-Trimethoxybenzene |
| Synonyms | 1,3,5-TriMetho TRISMETHOXYBENZENE 1,3,5-Methoxybenzene 1,3,5-Trimethoxybenzene 1,3,5-trimethoxy-benzen TRIMETHYL PHLOROGLUCINOL 1,3,5-Trimethyoxybenzene |
| CAS | 621-23-8 |
| EINECS | 210-673-4 |
| Chemical Formula | C9H12O3 |
| Molecular Weight | 168.19 |
| inchi | InChI=1/C9H12O3/c1-10-7-4-8(11-2)6-9(5-7)12-3/h4-6H,1-3H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |