| Supplier Name | Henan Research New Material Co., Ltd |
| Tel | |
| Mobile | +86 18137458807 |
| Fax | |
| sales021@researchvip.com | |
| Website | http://www.researchvip.com |
| Product Name | (1α,2α,3β,6β)-1,2,3,6-tetrahydro-3,6-methanophthalic anhydride |
| Alias | Exo-cis-5-Norbornene-2,3-dicarboxylic anhydride NSC 110659 exo-3,6-Methylene-1,2,3,6-tetrahydrophthalic anhydride exo-5-Norbornene-2,3-dicarboxylic anhydride (1alpha,2alpha,3beta,6beta)-1,2,3,6-Tetrahydro-3,6-methanophthalicanhydride |
| CAS | 2746-19-2 |
| EINECS | 220-384-5 |
| Chemical Formula | C9H8O3 |
| Molecular Weight | 164.158 |
| inchi | InChI=1/C9H8O3/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8/h1-2,4-7H,3H2/t4?,5?,6-,7+ |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2021-12-22 20:55:08 |